C18H23FN2O2 — CID 122140204
5-[[(3-ethoxy-7-oxaspiro[3.5]nonan-1-yl)amino]methyl]-2-fluorobenzonitrile (PubChem CID 122140204) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 5-[[(3-ethoxy-7-oxaspiro[3.5]nonan-1-yl)amino]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3-ethoxy-7-oxaspiro[3.5]nonan-1-yl)amino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 122140204 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 5-[[(3-ethoxy-7-oxaspiro[3.5]nonan-1-yl)amino]methyl]-2-fluorobenzonitrile |
| SMILES | CCOC1CC(NCc2ccc(F)c(C#N)c2)C12CCOCC2 |
| InChI | InChI=1S/C18H23FN2O2/c1-2-23-17-10-16(18(17)5-7-22-8-6-18)21-12-13-3-4-15(19)14(9-13)11-20/h3-4,9,16-17,21H,2,5-8,10,12H2,1H3 |
| InChIKey | KIOLJPYDTPCSAV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |