C18H27NO2 — CID 95971660
3-[[[(1R,3S)-3-ethoxyspiro[3.5]nonan-1-yl]amino]methyl]phenol (PubChem CID 95971660) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[[[(1R,3S)-3-ethoxyspiro[3.5]nonan-1-yl]amino]methyl]phenol.
| Compound Name | 3-[[[(1R,3S)-3-ethoxyspiro[3.5]nonan-1-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 95971660 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[[[(1R,3S)-3-ethoxyspiro[3.5]nonan-1-yl]amino]methyl]phenol |
| SMILES | CCO[C@H]1C[C@@H](NCc2cccc(O)c2)C12CCCCC2 |
| InChI | InChI=1S/C18H27NO2/c1-2-21-17-12-16(18(17)9-4-3-5-10-18)19-13-14-7-6-8-15(20)11-14/h6-8,11,16-17,19-20H,2-5,9-10,12-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | IIRGZAREOFZPFD-SJORKVTESA-N |
| XLogP | 3.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |