C14H16F3N3O2 — CID 122140721
1-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 122140721) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | 1-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 122140721 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | COCc1noc(C(C)N(C)Cc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H16F3N3O2/c1-8(14-18-12(7-21-3)19-22-14)20(2)6-9-4-10(15)13(17)11(16)5-9/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | FZJQPHJKSDVFHS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|