C6H9BrN2O2 — CID 70538358
5-(1-bromoethyl)-3-(methoxymethyl)-1,2,4-oxadiazole (PubChem CID 70538358) has the molecular formula C6H9BrN2O2 and a molecular weight of 221.05 g/mol. Its IUPAC name is 5-(1-bromoethyl)-3-(methoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-bromoethyl)-3-(methoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 70538358 |
| Molecular Formula | C6H9BrN2O2 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 5-(1-bromoethyl)-3-(methoxymethyl)-1,2,4-oxadiazole |
| SMILES | COCc1noc(C(C)Br)n1 |
| InChI | InChI=1S/C6H9BrN2O2/c1-4(7)6-8-5(3-10-2)9-11-6/h4H,3H2,1-2H3 |
| InChIKey | VLBWBPIGJPQEQJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|