C16H28N6O2 — CID 122141267
4-methyl-N'-(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)piperazine-1-carbohydrazide (PubChem CID 122141267) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-methyl-N'-(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)piperazine-1-carbohydrazide.
| Compound Name | 4-methyl-N'-(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)piperazine-1-carbohydrazide |
|---|---|
| PubChem CID | 122141267 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 4-methyl-N'-(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)piperazine-1-carbohydrazide |
| SMILES | CCC(CC)n1ncc(C(=O)NNC(=O)N2CCN(C)CC2)c1C |
| InChI | InChI=1S/C16H28N6O2/c1-5-13(6-2)22-12(3)14(11-17-22)15(23)18-19-16(24)21-9-7-20(4)8-10-21/h11,13H,5-10H2,1-4H3,(H,18,23)(H,19,24) |
| InChIKey | DOQPOYXHXQISDJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|