C17H16ClN3O4S2 — CID 122143423
4-chloro-N-[2-(2-methylphenyl)pyrazol-3-yl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 122143423) has the molecular formula C17H16ClN3O4S2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-methylphenyl)pyrazol-3-yl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(2-methylphenyl)pyrazol-3-yl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 122143423 |
| Molecular Formula | C17H16ClN3O4S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 4-chloro-N-[2-(2-methylphenyl)pyrazol-3-yl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccccc1-n1nccc1NS(=O)(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H16ClN3O4S2/c1-12-5-3-4-6-15(12)21-17(9-10-19-21)20-27(24,25)13-7-8-14(18)16(11-13)26(2,22)23/h3-11,20H,1-2H3 |
| InChIKey | IDIDUPLEBVLQML-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |