C14H16N6S — CID 122144238
5,7-dimethyl-2-(2,5,6-trimethylpyrimidin-4-yl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 122144238) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 5,7-dimethyl-2-(2,5,6-trimethylpyrimidin-4-yl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-2-(2,5,6-trimethylpyrimidin-4-yl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 122144238 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5,7-dimethyl-2-(2,5,6-trimethylpyrimidin-4-yl)sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(Sc3nc(C)nc(C)c3C)nc2n1 |
| InChI | InChI=1S/C14H16N6S/c1-7-6-8(2)20-13(15-7)18-14(19-20)21-12-9(3)10(4)16-11(5)17-12/h6H,1-5H3 |
| InChIKey | KTHCQYHWTTXXFE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |