C26H22N4S — CID 16761890
5,7-dimethyl-2-tritylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 16761890) has the molecular formula C26H22N4S and a molecular weight of 422.56 g/mol. Its IUPAC name is 5,7-dimethyl-2-tritylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-2-tritylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 16761890 |
| Molecular Formula | C26H22N4S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 5,7-dimethyl-2-tritylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(SC(c3ccccc3)(c3ccccc3)c3ccccc3)nc2n1 |
| InChI | InChI=1S/C26H22N4S/c1-19-18-20(2)30-24(27-19)28-25(29-30)31-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18H,1-2H3 |
| InChIKey | YCAWLZSFWOVMMO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|