C12H15N5O3S — CID 122144647
6-(methylsulfamoyl)-N-[1-(1H-pyrazol-5-yl)ethyl]pyridine-3-carboxamide (PubChem CID 122144647) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 6-(methylsulfamoyl)-N-[1-(1H-pyrazol-5-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-(methylsulfamoyl)-N-[1-(1H-pyrazol-5-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122144647 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 6-(methylsulfamoyl)-N-[1-(1H-pyrazol-5-yl)ethyl]pyridine-3-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC(C)c2ccn[nH]2)cn1 |
| InChI | InChI=1S/C12H15N5O3S/c1-8(10-5-6-15-17-10)16-12(18)9-3-4-11(14-7-9)21(19,20)13-2/h3-8,13H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | YZNVEQXWWHMYAN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |