C11H14N4O3S2 — CID 122153228
3-[[6-(methylsulfamoyl)pyridine-3-carbonyl]amino]propyl thiocyanate (PubChem CID 122153228) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[[6-(methylsulfamoyl)pyridine-3-carbonyl]amino]propyl thiocyanate.
| Compound Name | 3-[[6-(methylsulfamoyl)pyridine-3-carbonyl]amino]propyl thiocyanate |
|---|---|
| PubChem CID | 122153228 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-[[6-(methylsulfamoyl)pyridine-3-carbonyl]amino]propyl thiocyanate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCCCSC#N)cn1 |
| InChI | InChI=1S/C11H14N4O3S2/c1-13-20(17,18)10-4-3-9(7-15-10)11(16)14-5-2-6-19-8-12/h3-4,7,13H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | HKZXVOPZBVPCDG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|