C12H11Cl2N3O2 — CID 122145027
N-[1-(2,4-dichlorophenyl)pyrazol-4-yl]-2-hydroxypropanamide (PubChem CID 122145027) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)pyrazol-4-yl]-2-hydroxypropanamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)pyrazol-4-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 122145027 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)pyrazol-4-yl]-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)Nc1cnn(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-7(18)12(19)16-9-5-15-17(6-9)11-3-2-8(13)4-10(11)14/h2-7,18H,1H3,(H,16,19) |
| InChIKey | KREYJFRZGUWPNT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |