C12H13BrFNO2 — CID 122145963
N-(2-bromo-6-fluoro-3-methylphenyl)oxolane-2-carboxamide (PubChem CID 122145963) has the molecular formula C12H13BrFNO2 and a molecular weight of 302.14 g/mol. Its IUPAC name is N-(2-bromo-6-fluoro-3-methylphenyl)oxolane-2-carboxamide.
| Compound Name | N-(2-bromo-6-fluoro-3-methylphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 122145963 |
| Molecular Formula | C12H13BrFNO2 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-(2-bromo-6-fluoro-3-methylphenyl)oxolane-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)C2CCCO2)c1Br |
| InChI | InChI=1S/C12H13BrFNO2/c1-7-4-5-8(14)11(10(7)13)15-12(16)9-3-2-6-17-9/h4-5,9H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | XPGWAGIQPYBYIU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |