C13H13ClFNO4 — CID 126833169
methyl 3-chloro-6-fluoro-2-[[(2R)-oxolane-2-carbonyl]amino]benzoate (PubChem CID 126833169) has the molecular formula C13H13ClFNO4 and a molecular weight of 301.70 g/mol. Its IUPAC name is methyl 3-chloro-6-fluoro-2-[[(2R)-oxolane-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-chloro-6-fluoro-2-[[(2R)-oxolane-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 126833169 |
| Molecular Formula | C13H13ClFNO4 |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl 3-chloro-6-fluoro-2-[[(2R)-oxolane-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1c(F)ccc(Cl)c1NC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C13H13ClFNO4/c1-19-13(18)10-8(15)5-4-7(14)11(10)16-12(17)9-3-2-6-20-9/h4-5,9H,2-3,6H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | CAPAQEGLEKXBBT-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |