C21H26N2O5 — CID 122146089
ethyl 2-[3-(3,4-dimethoxyphenyl)propanoylamino]-2-pyridin-3-ylpropanoate (PubChem CID 122146089) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 2-[3-(3,4-dimethoxyphenyl)propanoylamino]-2-pyridin-3-ylpropanoate.
| Compound Name | ethyl 2-[3-(3,4-dimethoxyphenyl)propanoylamino]-2-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 122146089 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl 2-[3-(3,4-dimethoxyphenyl)propanoylamino]-2-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C(C)(NC(=O)CCc1ccc(OC)c(OC)c1)c1cccnc1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-28-20(25)21(2,16-7-6-12-22-14-16)23-19(24)11-9-15-8-10-17(26-3)18(13-15)27-4/h6-8,10,12-14H,5,9,11H2,1-4H3,(H,23,24) |
| InChIKey | FAYMBBSISCEPFY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |