C16H27N3O2 — CID 60992807
ethyl 2-[2-(diethylamino)ethylamino]-2-pyridin-3-ylpropanoate (PubChem CID 60992807) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl 2-[2-(diethylamino)ethylamino]-2-pyridin-3-ylpropanoate.
| Compound Name | ethyl 2-[2-(diethylamino)ethylamino]-2-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 60992807 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | ethyl 2-[2-(diethylamino)ethylamino]-2-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C(C)(NCCN(CC)CC)c1cccnc1 |
| InChI | InChI=1S/C16H27N3O2/c1-5-19(6-2)12-11-18-16(4,15(20)21-7-3)14-9-8-10-17-13-14/h8-10,13,18H,5-7,11-12H2,1-4H3 |
| InChIKey | WNEYXYPPIZMACZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |