C17H23NO6 — CID 6710382
triethyl 2-pyridin-3-ylpropane-1,2,3-tricarboxylate (PubChem CID 6710382) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is triethyl 2-pyridin-3-ylpropane-1,2,3-tricarboxylate.
| Compound Name | triethyl 2-pyridin-3-ylpropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 6710382 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | triethyl 2-pyridin-3-ylpropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)c1cccnc1 |
| InChI | InChI=1S/C17H23NO6/c1-4-22-14(19)10-17(16(21)24-6-3,11-15(20)23-5-2)13-8-7-9-18-12-13/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | URHHEHSZOVZLOC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|