C13H19N5O2 — CID 66189937
ethyl 2-(3-azidopropylamino)-2-pyridin-3-ylpropanoate (PubChem CID 66189937) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is ethyl 2-(3-azidopropylamino)-2-pyridin-3-ylpropanoate.
| Compound Name | ethyl 2-(3-azidopropylamino)-2-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 66189937 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | ethyl 2-(3-azidopropylamino)-2-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)C(C)(NCCCN=[N+]=[N-])c1cccnc1 |
| InChI | InChI=1S/C13H19N5O2/c1-3-20-12(19)13(2,11-6-4-7-15-10-11)16-8-5-9-17-18-14/h4,6-7,10,16H,3,5,8-9H2,1-2H3 |
| InChIKey | SCKHUFPGZZRIES-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|