C15H22N4O2 — CID 66189056
ethyl 2-(2-azidoethylamino)-2-(3,4-dimethylphenyl)propanoate (PubChem CID 66189056) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is ethyl 2-(2-azidoethylamino)-2-(3,4-dimethylphenyl)propanoate.
| Compound Name | ethyl 2-(2-azidoethylamino)-2-(3,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 66189056 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl 2-(2-azidoethylamino)-2-(3,4-dimethylphenyl)propanoate |
| SMILES | CCOC(=O)C(C)(NCCN=[N+]=[N-])c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H22N4O2/c1-5-21-14(20)15(4,17-8-9-18-19-16)13-7-6-11(2)12(3)10-13/h6-7,10,17H,5,8-9H2,1-4H3 |
| InChIKey | JKYPQSMNXBBRQT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|