C14H19BrN4O2 — CID 66190529
ethyl 2-(3-azidopropylamino)-2-(2-bromophenyl)propanoate (PubChem CID 66190529) has the molecular formula C14H19BrN4O2 and a molecular weight of 355.24 g/mol. Its IUPAC name is ethyl 2-(3-azidopropylamino)-2-(2-bromophenyl)propanoate.
| Compound Name | ethyl 2-(3-azidopropylamino)-2-(2-bromophenyl)propanoate |
|---|---|
| PubChem CID | 66190529 |
| Molecular Formula | C14H19BrN4O2 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | ethyl 2-(3-azidopropylamino)-2-(2-bromophenyl)propanoate |
| SMILES | CCOC(=O)C(C)(NCCCN=[N+]=[N-])c1ccccc1Br |
| InChI | InChI=1S/C14H19BrN4O2/c1-3-21-13(20)14(2,17-9-6-10-18-19-16)11-7-4-5-8-12(11)15/h4-5,7-8,17H,3,6,9-10H2,1-2H3 |
| InChIKey | ZSJDQPLERFPCQF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|