C16H22BrNO3 — CID 60993773
ethyl 2-(2-bromophenyl)-2-(oxolan-2-ylmethylamino)propanoate (PubChem CID 60993773) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is ethyl 2-(2-bromophenyl)-2-(oxolan-2-ylmethylamino)propanoate.
| Compound Name | ethyl 2-(2-bromophenyl)-2-(oxolan-2-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 60993773 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 2-(2-bromophenyl)-2-(oxolan-2-ylmethylamino)propanoate |
| SMILES | CCOC(=O)C(C)(NCC1CCCO1)c1ccccc1Br |
| InChI | InChI=1S/C16H22BrNO3/c1-3-20-15(19)16(2,13-8-4-5-9-14(13)17)18-11-12-7-6-10-21-12/h4-5,8-9,12,18H,3,6-7,10-11H2,1-2H3 |
| InChIKey | KMQGEOWFDDXAEN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |