C14H17BrFNO3 — CID 82966847
2-(4-bromo-2-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid (PubChem CID 82966847) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 82966847 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid |
| SMILES | CC(NCC1CCCO1)(C(=O)O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H17BrFNO3/c1-14(13(18)19,17-8-10-3-2-6-20-10)11-5-4-9(15)7-12(11)16/h4-5,7,10,17H,2-3,6,8H2,1H3,(H,18,19) |
| InChIKey | MVERCNQVIYGVGK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |