C14H16Cl2FNO3 — CID 60993059
2-(2,4-dichloro-5-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid (PubChem CID 60993059) has the molecular formula C14H16Cl2FNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 60993059 |
| Molecular Formula | C14H16Cl2FNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-2-(oxolan-2-ylmethylamino)propanoic acid |
| SMILES | CC(NCC1CCCO1)(C(=O)O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2FNO3/c1-14(13(19)20,18-7-8-3-2-4-21-8)9-5-12(17)11(16)6-10(9)15/h5-6,8,18H,2-4,7H2,1H3,(H,19,20) |
| InChIKey | OWIPCCSSVODTRO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|