C15H21NO4 — CID 60993337
methyl 2-(3-hydroxyphenyl)-2-(oxolan-2-ylmethylamino)propanoate (PubChem CID 60993337) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 2-(3-hydroxyphenyl)-2-(oxolan-2-ylmethylamino)propanoate.
| Compound Name | methyl 2-(3-hydroxyphenyl)-2-(oxolan-2-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 60993337 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl 2-(3-hydroxyphenyl)-2-(oxolan-2-ylmethylamino)propanoate |
| SMILES | COC(=O)C(C)(NCC1CCCO1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H21NO4/c1-15(14(18)19-2,11-5-3-6-12(17)9-11)16-10-13-7-4-8-20-13/h3,5-6,9,13,16-17H,4,7-8,10H2,1-2H3 |
| InChIKey | FOWWHRAMVNKIAN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |