C11H13BrN4O2 — CID 66189213
2-(2-azidoethylamino)-2-(2-bromophenyl)propanoic acid (PubChem CID 66189213) has the molecular formula C11H13BrN4O2 and a molecular weight of 313.16 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(2-bromophenyl)propanoic acid.
| Compound Name | 2-(2-azidoethylamino)-2-(2-bromophenyl)propanoic acid |
|---|---|
| PubChem CID | 66189213 |
| Molecular Formula | C11H13BrN4O2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(2-bromophenyl)propanoic acid |
| SMILES | CC(NCCN=[N+]=[N-])(C(=O)O)c1ccccc1Br |
| InChI | InChI=1S/C11H13BrN4O2/c1-11(10(17)18,14-6-7-15-16-13)8-4-2-3-5-9(8)12/h2-5,14H,6-7H2,1H3,(H,17,18) |
| InChIKey | KHSSBGJJGFQPBA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|