C12H14Cl2N4O2 — CID 66191278
2-(3-azidopropylamino)-2-(2,4-dichlorophenyl)propanoic acid (PubChem CID 66191278) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(2,4-dichlorophenyl)propanoic acid.
| Compound Name | 2-(3-azidopropylamino)-2-(2,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 66191278 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(2,4-dichlorophenyl)propanoic acid |
| SMILES | CC(NCCCN=[N+]=[N-])(C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O2/c1-12(11(19)20,16-5-2-6-17-18-15)9-4-3-8(13)7-10(9)14/h3-4,7,16H,2,5-6H2,1H3,(H,19,20) |
| InChIKey | AXPCPTOSEBATOE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|