C13H19N5O3 — CID 66165562
2-(3-azidopropylamino)-2-(4-hydroxy-3-methoxyphenyl)propanamide (PubChem CID 66165562) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(4-hydroxy-3-methoxyphenyl)propanamide.
| Compound Name | 2-(3-azidopropylamino)-2-(4-hydroxy-3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 66165562 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(4-hydroxy-3-methoxyphenyl)propanamide |
| SMILES | COc1cc(C(C)(NCCCN=[N+]=[N-])C(N)=O)ccc1O |
| InChI | InChI=1S/C13H19N5O3/c1-13(12(14)20,16-6-3-7-17-18-15)9-4-5-10(19)11(8-9)21-2/h4-5,8,16,19H,3,6-7H2,1-2H3,(H2,14,20) |
| InChIKey | QZMUJOZOKYKMQG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|