C12H16IN5O — CID 114083108
2-(3-azidopropylamino)-2-(4-iodophenyl)propanamide (PubChem CID 114083108) has the molecular formula C12H16IN5O and a molecular weight of 373.20 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(4-iodophenyl)propanamide.
| Compound Name | 2-(3-azidopropylamino)-2-(4-iodophenyl)propanamide |
|---|---|
| PubChem CID | 114083108 |
| Molecular Formula | C12H16IN5O |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(4-iodophenyl)propanamide |
| SMILES | CC(NCCCN=[N+]=[N-])(C(N)=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H16IN5O/c1-12(11(14)19,16-7-2-8-17-18-15)9-3-5-10(13)6-4-9/h3-6,16H,2,7-8H2,1H3,(H2,14,19) |
| InChIKey | DCIHQOYDXWGZIA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|