C13H18FN5O — CID 114832222
2-(3-azidopropylamino)-3-(4-fluorophenyl)-2-methylpropanamide (PubChem CID 114832222) has the molecular formula C13H18FN5O and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-3-(4-fluorophenyl)-2-methylpropanamide.
| Compound Name | 2-(3-azidopropylamino)-3-(4-fluorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 114832222 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(3-azidopropylamino)-3-(4-fluorophenyl)-2-methylpropanamide |
| SMILES | CC(Cc1ccc(F)cc1)(NCCCN=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C13H18FN5O/c1-13(12(15)20,17-7-2-8-18-19-16)9-10-3-5-11(14)6-4-10/h3-6,17H,2,7-9H2,1H3,(H2,15,20) |
| InChIKey | WKRSJEWQEYTJEE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|