C11H15FN6O — CID 83119646
2-(3-azidopropylamino)-2-(5-fluoro-2-pyridinyl)propanamide (PubChem CID 83119646) has the molecular formula C11H15FN6O and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(5-fluoro-2-pyridinyl)propanamide.
| Compound Name | 2-(3-azidopropylamino)-2-(5-fluoro-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 83119646 |
| Molecular Formula | C11H15FN6O |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(5-fluoro-2-pyridinyl)propanamide |
| SMILES | CC(NCCCN=[N+]=[N-])(C(N)=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H15FN6O/c1-11(10(13)19,16-5-2-6-17-18-14)9-4-3-8(12)7-15-9/h3-4,7,16H,2,5-6H2,1H3,(H2,13,19) |
| InChIKey | IFNGSOCRJRKLFQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|