C11H12F2N4O2 — CID 66190200
2-(2-azidoethylamino)-2-(2,4-difluorophenyl)propanoic acid (PubChem CID 66190200) has the molecular formula C11H12F2N4O2 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(2,4-difluorophenyl)propanoic acid.
| Compound Name | 2-(2-azidoethylamino)-2-(2,4-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 66190200 |
| Molecular Formula | C11H12F2N4O2 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(2,4-difluorophenyl)propanoic acid |
| SMILES | CC(NCCN=[N+]=[N-])(C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N4O2/c1-11(10(18)19,15-4-5-16-17-14)8-3-2-7(12)6-9(8)13/h2-3,6,15H,4-5H2,1H3,(H,18,19) |
| InChIKey | PDDQMWSRIIASPJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|