C13H18N4O2 — CID 66188813
2-(2-azidoethylamino)-2-(2,4-dimethylphenyl)propanoic acid (PubChem CID 66188813) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(2,4-dimethylphenyl)propanoic acid.
| Compound Name | 2-(2-azidoethylamino)-2-(2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 66188813 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(2,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C(C)(NCCN=[N+]=[N-])C(=O)O)c(C)c1 |
| InChI | InChI=1S/C13H18N4O2/c1-9-4-5-11(10(2)8-9)13(3,12(18)19)15-6-7-16-17-14/h4-5,8,15H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | VPHOYDPRYLPACV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|