C18H27NO2 — CID 60997722
2-(cycloheptylamino)-2-(2,4-dimethylphenyl)propanoic acid (PubChem CID 60997722) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(cycloheptylamino)-2-(2,4-dimethylphenyl)propanoic acid.
| Compound Name | 2-(cycloheptylamino)-2-(2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 60997722 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(cycloheptylamino)-2-(2,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C(C)(NC2CCCCCC2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H27NO2/c1-13-10-11-16(14(2)12-13)18(3,17(20)21)19-15-8-6-4-5-7-9-15/h10-12,15,19H,4-9H2,1-3H3,(H,20,21) |
| InChIKey | FUARWJMPAOJKFA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |