C14H17Cl2NO2 — CID 61002117
2-(cyclopentylamino)-2-(2,5-dichlorophenyl)propanoic acid (PubChem CID 61002117) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(2,5-dichlorophenyl)propanoic acid.
| Compound Name | 2-(cyclopentylamino)-2-(2,5-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 61002117 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(cyclopentylamino)-2-(2,5-dichlorophenyl)propanoic acid |
| SMILES | CC(NC1CCCC1)(C(=O)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(13(18)19,17-10-4-2-3-5-10)11-8-9(15)6-7-12(11)16/h6-8,10,17H,2-5H2,1H3,(H,18,19) |
| InChIKey | HXMVROXQFBGPQB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |