C14H17BrClNO2 — CID 82773455
2-(4-bromo-2-chlorophenyl)-2-(cyclopentylamino)propanoic acid (PubChem CID 82773455) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-2-(cyclopentylamino)propanoic acid.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-2-(cyclopentylamino)propanoic acid |
|---|---|
| PubChem CID | 82773455 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-2-(cyclopentylamino)propanoic acid |
| SMILES | CC(NC1CCCC1)(C(=O)O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H17BrClNO2/c1-14(13(18)19,17-10-4-2-3-5-10)11-7-6-9(15)8-12(11)16/h6-8,10,17H,2-5H2,1H3,(H,18,19) |
| InChIKey | ZLFJIVLJWLHLEW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |