C15H21NO4 — CID 107707552
2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanoic acid (PubChem CID 107707552) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 107707552 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanoic acid |
| SMILES | CC(NC1CCCCC1)(C(=O)O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H21NO4/c1-15(14(19)20,16-11-5-3-2-4-6-11)10-7-12(17)9-13(18)8-10/h7-9,11,16-18H,2-6H2,1H3,(H,19,20) |
| InChIKey | JOKICYWAMWQPKD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |