C15H22N2O3 — CID 107707551
2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanamide (PubChem CID 107707551) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanamide.
| Compound Name | 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 107707551 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(cyclohexylamino)-2-(3,5-dihydroxyphenyl)propanamide |
| SMILES | CC(NC1CCCCC1)(C(N)=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-15(14(16)20,17-11-5-3-2-4-6-11)10-7-12(18)9-13(19)8-10/h7-9,11,17-19H,2-6H2,1H3,(H2,16,20) |
| InChIKey | ZBOGOGPXFKIEJS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |