C16H22F2N2O — CID 60997602
2-(cycloheptylamino)-2-(2,4-difluorophenyl)propanamide (PubChem CID 60997602) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-(cycloheptylamino)-2-(2,4-difluorophenyl)propanamide.
| Compound Name | 2-(cycloheptylamino)-2-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 60997602 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-(cycloheptylamino)-2-(2,4-difluorophenyl)propanamide |
| SMILES | CC(NC1CCCCCC1)(C(N)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O/c1-16(15(19)21,13-9-8-11(17)10-14(13)18)20-12-6-4-2-3-5-7-12/h8-10,12,20H,2-7H2,1H3,(H2,19,21) |
| InChIKey | XPCKWWQVQBKROJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |