C16H21F2NO2 — CID 60997342
ethyl 2-(cyclopentylamino)-2-(2,5-difluorophenyl)propanoate (PubChem CID 60997342) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl 2-(cyclopentylamino)-2-(2,5-difluorophenyl)propanoate.
| Compound Name | ethyl 2-(cyclopentylamino)-2-(2,5-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 60997342 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | ethyl 2-(cyclopentylamino)-2-(2,5-difluorophenyl)propanoate |
| SMILES | CCOC(=O)C(C)(NC1CCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H21F2NO2/c1-3-21-15(20)16(2,19-12-6-4-5-7-12)13-10-11(17)8-9-14(13)18/h8-10,12,19H,3-7H2,1-2H3 |
| InChIKey | OBYLLOTYOUOEIF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |