C10H15N5O2S — CID 66188847
ethyl 2-(2-azidoethylamino)-2-(1,3-thiazol-2-yl)propanoate (PubChem CID 66188847) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is ethyl 2-(2-azidoethylamino)-2-(1,3-thiazol-2-yl)propanoate.
| Compound Name | ethyl 2-(2-azidoethylamino)-2-(1,3-thiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 66188847 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl 2-(2-azidoethylamino)-2-(1,3-thiazol-2-yl)propanoate |
| SMILES | CCOC(=O)C(C)(NCCN=[N+]=[N-])c1nccs1 |
| InChI | InChI=1S/C10H15N5O2S/c1-3-17-9(16)10(2,8-12-6-7-18-8)13-4-5-14-15-11/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | DYSNXIIPZHOCHI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|