C16H26N2O3 — CID 61001179
ethyl 2-[2-(dimethylamino)ethylamino]-2-(3-methoxyphenyl)propanoate (PubChem CID 61001179) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl 2-[2-(dimethylamino)ethylamino]-2-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-[2-(dimethylamino)ethylamino]-2-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 61001179 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethyl 2-[2-(dimethylamino)ethylamino]-2-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C)(NCCN(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-6-21-15(19)16(2,17-10-11-18(3)4)13-8-7-9-14(12-13)20-5/h7-9,12,17H,6,10-11H2,1-5H3 |
| InChIKey | HFBMXGZHWCGYOZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |