C12H11F3N4O2 — CID 122147106
1-[2-(difluoromethoxy)-4-fluorophenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea (PubChem CID 122147106) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 122147106 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(F)cc2OC(F)F)n[nH]1 |
| InChI | InChI=1S/C12H11F3N4O2/c1-6-4-10(19-18-6)17-12(20)16-8-3-2-7(13)5-9(8)21-11(14)15/h2-5,11H,1H3,(H3,16,17,18,19,20) |
| InChIKey | QMZQZYQLQXULNE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |