C14H18F3N3O5 — CID 97261314
1-[2-(difluoromethoxy)-4-fluorophenyl]-3-[[(2S)-2-(2-methoxyethoxy)propanoyl]amino]urea (PubChem CID 97261314) has the molecular formula C14H18F3N3O5 and a molecular weight of 365.31 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-[[(2S)-2-(2-methoxyethoxy)propanoyl]amino]urea.
| Compound Name | 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-[[(2S)-2-(2-methoxyethoxy)propanoyl]amino]urea |
|---|---|
| PubChem CID | 97261314 |
| Molecular Formula | C14H18F3N3O5 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-fluorophenyl]-3-[[(2S)-2-(2-methoxyethoxy)propanoyl]amino]urea |
| SMILES | COCCO[C@@H](C)C(=O)NNC(=O)Nc1ccc(F)cc1OC(F)F |
| InChI | InChI=1S/C14H18F3N3O5/c1-8(24-6-5-23-2)12(21)19-20-14(22)18-10-4-3-9(15)7-11(10)25-13(16)17/h3-4,7-8,13H,5-6H2,1-2H3,(H,19,21)(H2,18,20,22)/t8-/m0/s1 |
| InChIKey | DGEDWMBJDMLWKH-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|