C16H18N2O3S — CID 122147122
(2S)-2-amino-N-[2-(benzenesulfonylmethyl)phenyl]propanamide (PubChem CID 122147122) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(benzenesulfonylmethyl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-(benzenesulfonylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 122147122 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S)-2-amino-N-[2-(benzenesulfonylmethyl)phenyl]propanamide |
| SMILES | C[C@H](N)C(=O)Nc1ccccc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3S/c1-12(17)16(19)18-15-10-6-5-7-13(15)11-22(20,21)14-8-3-2-4-9-14/h2-10,12H,11,17H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | NHTSCOALBVEOLD-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |