C13H18Cl2N2O3 — CID 122148196
N-[2-(2-chlorophenyl)-2-hydroxyethyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 122148196) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-hydroxyethyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(2-chlorophenyl)-2-hydroxyethyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122148196 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-hydroxyethyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC(O)c1ccccc1Cl)C1CNCCO1 |
| InChI | InChI=1S/C13H17ClN2O3.ClH/c14-10-4-2-1-3-9(10)11(17)7-16-13(18)12-8-15-5-6-19-12;/h1-4,11-12,15,17H,5-8H2,(H,16,18);1H |
| InChIKey | BHASMIPCAOCZPJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |