C16H24N2O — CID 122149010
1-(4-amino-2-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-one (PubChem CID 122149010) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(4-amino-2-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-one.
| Compound Name | 1-(4-amino-2-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 122149010 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(4-amino-2-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-one |
| SMILES | CC(Cc1ccccc1)C(=O)N1CCC(N)CC1C |
| InChI | InChI=1S/C16H24N2O/c1-12(10-14-6-4-3-5-7-14)16(19)18-9-8-15(17)11-13(18)2/h3-7,12-13,15H,8-11,17H2,1-2H3 |
| InChIKey | KWTNMTYQMSZMCN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |