About 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one
3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one (PubChem CID 122149458) has the molecular formula C15H16N4OS2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one |
| PubChem CID | 122149458 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one |
| SMILES | CN(C)c1nnc(SCc2cc3ccccc3n(C)c2=O)s1 |
| InChI | InChI=1S/C15H16N4OS2/c1-18(2)14-16-17-15(22-14)21-9-11-8-10-6-4-5-7-12(10)19(3)13(11)20/h4-8H,9H2,1-3H3 |
| InChIKey | AESMAABFFODMMY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one?
The IUPAC name of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one (CID 122149458) is 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one.
What is the SMILES notation for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one?
The canonical SMILES for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one is CN(C)c1nnc(SCc2cc3ccccc3n(C)c2=O)s1.
What is the InChIKey of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one?
The InChIKey is AESMAABFFODMMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4OS2/c1-18(2)14-16-17-15(22-14)21-9-11-8-10-6-4-5-7-12(10)19(3)13(11)20/h4-8H,9H2,1-3H3.
What are the key properties of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one?
3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one has a molecular weight of 332.45 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-methylquinolin-2-one is sourced from PubChem (CID 122149458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).