C26H24N4O2 — CID 122149765
N'-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]-N-(3-methyl-4-phenylphenyl)oxamide (PubChem CID 122149765) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N'-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]-N-(3-methyl-4-phenylphenyl)oxamide.
| Compound Name | N'-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]-N-(3-methyl-4-phenylphenyl)oxamide |
|---|---|
| PubChem CID | 122149765 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N'-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]-N-(3-methyl-4-phenylphenyl)oxamide |
| SMILES | Cc1ccc(-n2nc(NC(=O)C(=O)Nc3ccc(-c4ccccc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-17-9-12-22(13-10-17)30-19(3)16-24(29-30)28-26(32)25(31)27-21-11-14-23(18(2)15-21)20-7-5-4-6-8-20/h4-16H,1-3H3,(H,27,31)(H,28,29,32) |
| InChIKey | HBKZDIZYOMLMMI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|