C19H18F2N4O2S2 — CID 122149768
N'-benzyl-N'-(2,2-difluoroethyl)-N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]oxamide (PubChem CID 122149768) has the molecular formula C19H18F2N4O2S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is N'-benzyl-N'-(2,2-difluoroethyl)-N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]oxamide.
| Compound Name | N'-benzyl-N'-(2,2-difluoroethyl)-N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]oxamide |
|---|---|
| PubChem CID | 122149768 |
| Molecular Formula | C19H18F2N4O2S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N'-benzyl-N'-(2,2-difluoroethyl)-N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]oxamide |
| SMILES | Cc1nc(C)c(-c2csc(NC(=O)C(=O)N(Cc3ccccc3)CC(F)F)n2)s1 |
| InChI | InChI=1S/C19H18F2N4O2S2/c1-11-16(29-12(2)22-11)14-10-28-19(23-14)24-17(26)18(27)25(9-15(20)21)8-13-6-4-3-5-7-13/h3-7,10,15H,8-9H2,1-2H3,(H,23,24,26) |
| InChIKey | JTTYBTDBAYYXCB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|