C18H17FN4O2 — CID 122150700
1-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-3-(4-hydroxy-2-methylphenyl)urea (PubChem CID 122150700) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-3-(4-hydroxy-2-methylphenyl)urea.
| Compound Name | 1-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-3-(4-hydroxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 122150700 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-3-(4-hydroxy-2-methylphenyl)urea |
| SMILES | Cc1cc(O)ccc1NC(=O)Nc1cnn(-c2ccccc2F)c1C |
| InChI | InChI=1S/C18H17FN4O2/c1-11-9-13(24)7-8-15(11)21-18(25)22-16-10-20-23(12(16)2)17-6-4-3-5-14(17)19/h3-10,24H,1-2H3,(H2,21,22,25) |
| InChIKey | FZZKDCFFHLXWQN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|