C15H17FN4O3 — CID 122087341
4-[[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]carbamoylamino]butanoic acid (PubChem CID 122087341) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 4-[[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122087341 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-[[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]carbamoylamino]butanoic acid |
| SMILES | Cc1c(NC(=O)NCCCC(=O)O)cnn1-c1ccccc1F |
| InChI | InChI=1S/C15H17FN4O3/c1-10-12(19-15(23)17-8-4-7-14(21)22)9-18-20(10)13-6-3-2-5-11(13)16/h2-3,5-6,9H,4,7-8H2,1H3,(H,21,22)(H2,17,19,23) |
| InChIKey | RFDMAASSBPWBTJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|